About 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate
3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate (PubChem CID 87620797) has the molecular formula C12H15NO8
and a molecular weight of 301.25 g/mol. Its IUPAC name is 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate.
Molecular Properties
| Compound Name | 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate |
| PubChem CID | 87620797 |
| Molecular Formula | C12H15NO8 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate |
| SMILES | CC(=O)CC(=O)OC(=O)CC/C(=N/O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C12H15NO8/c1-7(14)5-11(17)20-9(13-19)3-4-10(16)21-12(18)6-8(2)15/h19H,3-6H2,1-2H3/b13-9- |
| InChIKey | GDFUEWSXISXIEL-LCYFTJDESA-N |
| XLogP | 0.13 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate?
The IUPAC name of 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate (CID 87620797) is 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate.
What is the SMILES notation for 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate?
The canonical SMILES for 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate is CC(=O)CC(=O)OC(=O)CC/C(=N/O)OC(=O)CC(C)=O.
What is the InChIKey of 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate?
The InChIKey is GDFUEWSXISXIEL-LCYFTJDESA-N. The full InChI is InChI=1S/C12H15NO8/c1-7(14)5-11(17)20-9(13-19)3-4-10(16)21-12(18)6-8(2)15/h19H,3-6H2,1-2H3/b13-9-.
What are the key properties of 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate?
3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate has a molecular weight of 301.25 g/mol, XLogP of 0.13, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoyl (4Z)-4-hydroxyimino-4-(3-oxobutanoyloxy)butanoate is sourced from PubChem (CID 87620797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).