C12H20N2O4 — CID 87636352
3-[(Z)-2-aminobut-2-enoyl]oxybutyl (Z)-2-aminobut-2-enoate (PubChem CID 87636352) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[(Z)-2-aminobut-2-enoyl]oxybutyl (Z)-2-aminobut-2-enoate.
| Compound Name | 3-[(Z)-2-aminobut-2-enoyl]oxybutyl (Z)-2-aminobut-2-enoate |
|---|---|
| PubChem CID | 87636352 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[(Z)-2-aminobut-2-enoyl]oxybutyl (Z)-2-aminobut-2-enoate |
| SMILES | C/C=C(\N)C(=O)OCCC(C)OC(=O)/C(N)=C/C |
| InChI | InChI=1S/C12H20N2O4/c1-4-9(13)11(15)17-7-6-8(3)18-12(16)10(14)5-2/h4-5,8H,6-7,13-14H2,1-3H3/b9-4-,10-5- |
| InChIKey | NAXKNEUCRVAWOX-AVWDGMTFSA-N |
| XLogP | 0.58 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|