C23H21FO5S — CID 87637412
2-[[7-(2-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 87637412) has the molecular formula C23H21FO5S and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[[7-(2-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[7-(2-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87637412 |
| Molecular Formula | C23H21FO5S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[[7-(2-fluorophenyl)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | COc1cc2c(c(-c3ccccc3F)c1)OC(Cc1cc(C)ccc1S(=O)(=O)O)C2 |
| InChI | InChI=1S/C23H21FO5S/c1-14-7-8-22(30(25,26)27)15(9-14)10-18-12-16-11-17(28-2)13-20(23(16)29-18)19-5-3-4-6-21(19)24/h3-9,11,13,18H,10,12H2,1-2H3,(H,25,26,27) |
| InChIKey | CMKQJUUEHNAWOT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|