C17H16N8O2 — CID 87648041
methyl N-cyano-N-[3-[[6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazin-2-yl]amino]phenyl]carbamate (PubChem CID 87648041) has the molecular formula C17H16N8O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is methyl N-cyano-N-[3-[[6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazin-2-yl]amino]phenyl]carbamate.
| Compound Name | methyl N-cyano-N-[3-[[6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazin-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87648041 |
| Molecular Formula | C17H16N8O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl N-cyano-N-[3-[[6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrazin-2-yl]amino]phenyl]carbamate |
| SMILES | COC(=O)N(C#N)c1cccc(Nc2cncc(Nc3cc(C)[nH]n3)n2)c1 |
| InChI | InChI=1S/C17H16N8O2/c1-11-6-14(24-23-11)21-16-9-19-8-15(22-16)20-12-4-3-5-13(7-12)25(10-18)17(26)27-2/h3-9H,1-2H3,(H3,20,21,22,23,24) |
| InChIKey | DDOWHSXFQHCONR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|