About sodium;propan-2-ol;hydroxide
sodium;propan-2-ol;hydroxide (PubChem CID 87652802) has the molecular formula C3H9NaO2
and a molecular weight of 100.09 g/mol. Its IUPAC name is sodium;propan-2-ol;hydroxide.
Molecular Properties
| Compound Name | sodium;propan-2-ol;hydroxide |
| PubChem CID | 87652802 |
| Molecular Formula | C3H9NaO2 |
| Molecular Weight | 100.09 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | sodium;propan-2-ol;hydroxide |
| SMILES | CC(C)O.[Na+].[OH-] |
| InChI | InChI=1S/C3H8O.Na.H2O/c1-3(2)4;;/h3-4H,1-2H3;;1H2/q;+1;/p-1 |
| InChIKey | JYGQNQHGQBEFJQ-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 50.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.09 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;propan-2-ol;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;propan-2-ol;hydroxide?
The IUPAC name of sodium;propan-2-ol;hydroxide (CID 87652802) is sodium;propan-2-ol;hydroxide.
What is the SMILES notation for sodium;propan-2-ol;hydroxide?
The canonical SMILES for sodium;propan-2-ol;hydroxide is CC(C)O.[Na+].[OH-].
What is the InChIKey of sodium;propan-2-ol;hydroxide?
The InChIKey is JYGQNQHGQBEFJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O.Na.H2O/c1-3(2)4;;/h3-4H,1-2H3;;1H2/q;+1;/p-1.
What are the key properties of sodium;propan-2-ol;hydroxide?
sodium;propan-2-ol;hydroxide has a molecular weight of 100.09 g/mol, XLogP of -2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;propan-2-ol;hydroxide is sourced from PubChem (CID 87652802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).