About S-thiophen-2-yl butanethioate
S-thiophen-2-yl butanethioate (PubChem CID 87653443) has the molecular formula C8H10OS2
and a molecular weight of 186.30 g/mol. Its IUPAC name is S-thiophen-2-yl butanethioate.
Molecular Properties
| Compound Name | S-thiophen-2-yl butanethioate |
| PubChem CID | 87653443 |
| Molecular Formula | C8H10OS2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | S-thiophen-2-yl butanethioate |
| SMILES | CCCC(=O)Sc1cccs1 |
| InChI | InChI=1S/C8H10OS2/c1-2-4-7(9)11-8-5-3-6-10-8/h3,5-6H,2,4H2,1H3 |
| InChIKey | RGWSBDARAQFFON-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-thiophen-2-yl butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-thiophen-2-yl butanethioate?
The IUPAC name of S-thiophen-2-yl butanethioate (CID 87653443) is S-thiophen-2-yl butanethioate.
What is the SMILES notation for S-thiophen-2-yl butanethioate?
The canonical SMILES for S-thiophen-2-yl butanethioate is CCCC(=O)Sc1cccs1.
What is the InChIKey of S-thiophen-2-yl butanethioate?
The InChIKey is RGWSBDARAQFFON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS2/c1-2-4-7(9)11-8-5-3-6-10-8/h3,5-6H,2,4H2,1H3.
What are the key properties of S-thiophen-2-yl butanethioate?
S-thiophen-2-yl butanethioate has a molecular weight of 186.30 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-thiophen-2-yl butanethioate is sourced from PubChem (CID 87653443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).