C11H15ClN2O2S — CID 87654943
1-tert-butyl-3-(3-chloro-4-hydroxyphenyl)-1-sulfanylurea (PubChem CID 87654943) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 1-tert-butyl-3-(3-chloro-4-hydroxyphenyl)-1-sulfanylurea.
| Compound Name | 1-tert-butyl-3-(3-chloro-4-hydroxyphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87654943 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-tert-butyl-3-(3-chloro-4-hydroxyphenyl)-1-sulfanylurea |
| SMILES | CC(C)(C)N(S)C(=O)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-11(2,3)14(17)10(16)13-7-4-5-9(15)8(12)6-7/h4-6,15,17H,1-3H3,(H,13,16) |
| InChIKey | AQGMXWLBCOGBTF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|