C16H13NO5 — CID 876555
methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate (PubChem CID 876555) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate.
| Compound Name | methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate |
|---|---|
| PubChem CID | 876555 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H13NO5/c1-20-16(19)10-2-5-12(6-3-10)17-15(18)11-4-7-13-14(8-11)22-9-21-13/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | AXLKBOLVTDFBQM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |