methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate

C16H13NO5 — CID 876555

IUPACmethyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1
InChIInChI=1S/C16H13NO5/c1-20-16(19)10-2-5-12(6-3-10)17-15(18)11-4-7-13-14(8-11)22-9-21-13/h2-8H,9H2,1H3,(H,17,18)
InChIKeyAXLKBOLVTDFBQM-UHFFFAOYSA-N
MW299.28 g/mol
LogP2.45
Rot. Bonds3

About methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate

methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate (PubChem CID 876555) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate.

Molecular Properties

Compound Namemethyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate
PubChem CID876555
Molecular FormulaC16H13NO5
Molecular Weight299.28 g/mol
Exact Mass299.08
IUPAC Namemethyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1
InChIInChI=1S/C16H13NO5/c1-20-16(19)10-2-5-12(6-3-10)17-15(18)11-4-7-13-14(8-11)22-9-21-13/h2-8H,9H2,1H3,(H,17,18)
InChIKeyAXLKBOLVTDFBQM-UHFFFAOYSA-N
XLogP2.45
TPSA73.86 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.28
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate?
The IUPAC name of methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate (CID 876555) is methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate.
What is the SMILES notation for methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate?
The canonical SMILES for methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate is COC(=O)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate?
The InChIKey is AXLKBOLVTDFBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5/c1-20-16(19)10-2-5-12(6-3-10)17-15(18)11-4-7-13-14(8-11)22-9-21-13/h2-8H,9H2,1H3,(H,17,18).
What are the key properties of methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate?
methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate has a molecular weight of 299.28 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,3-benzodioxole-5-carbonylamino)benzoate is sourced from PubChem (CID 876555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).