About 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate
1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate (PubChem CID 87656388) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate |
| PubChem CID | 87656388 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate |
| SMILES | CCOC(=O)C(CC)CC(=O)OC(C)O |
| InChI | InChI=1S/C10H18O5/c1-4-8(10(13)14-5-2)6-9(12)15-7(3)11/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | ZMJIPLUVWKDWTM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate?
The IUPAC name of 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate (CID 87656388) is 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate?
The canonical SMILES for 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate is CCOC(=O)C(CC)CC(=O)OC(C)O.
What is the InChIKey of 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate?
The InChIKey is ZMJIPLUVWKDWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-4-8(10(13)14-5-2)6-9(12)15-7(3)11/h7-8,11H,4-6H2,1-3H3.
What are the key properties of 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate?
1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate has a molecular weight of 218.25 g/mol, XLogP of 0.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-(1-hydroxyethyl) 2-ethylbutanedioate is sourced from PubChem (CID 87656388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).