C15H27NO4S — CID 87657580
5-hydroxy-2-methylbenzenesulfonate;tetraethylazanium (PubChem CID 87657580) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is 5-hydroxy-2-methylbenzenesulfonate;tetraethylazanium.
| Compound Name | 5-hydroxy-2-methylbenzenesulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 87657580 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-hydroxy-2-methylbenzenesulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.Cc1ccc(O)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C8H20N.C7H8O4S/c1-5-9(6-2,7-3)8-4;1-5-2-3-6(8)4-7(5)12(9,10)11/h5-8H2,1-4H3;2-4,8H,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | CNSSEMBPCGHUDK-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|