C17H13BrN4O3 — CID 87658566
2-(4-bromophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide (PubChem CID 87658566) has the molecular formula C17H13BrN4O3 and a molecular weight of 401.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide.
| Compound Name | 2-(4-bromophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
|---|---|
| PubChem CID | 87658566 |
| Molecular Formula | C17H13BrN4O3 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-(4-bromophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
| SMILES | NC(=O)C(Nc1c(Nc2ccncc2)c(=O)c1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H13BrN4O3/c18-10-3-1-9(2-4-10)12(17(19)25)22-14-13(15(23)16(14)24)21-11-5-7-20-8-6-11/h1-8,12,22H,(H2,19,25)(H,20,21) |
| InChIKey | OSBHAEFLJSXRLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|