C23H19N5O3 — CID 87658670
2-[4-(2-aminophenyl)phenyl]-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide (PubChem CID 87658670) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-[4-(2-aminophenyl)phenyl]-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide.
| Compound Name | 2-[4-(2-aminophenyl)phenyl]-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
|---|---|
| PubChem CID | 87658670 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-(2-aminophenyl)phenyl]-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
| SMILES | NC(=O)C(Nc1c(Nc2ccncc2)c(=O)c1=O)c1ccc(-c2ccccc2N)cc1 |
| InChI | InChI=1S/C23H19N5O3/c24-17-4-2-1-3-16(17)13-5-7-14(8-6-13)18(23(25)31)28-20-19(21(29)22(20)30)27-15-9-11-26-12-10-15/h1-12,18,28H,24H2,(H2,25,31)(H,26,27) |
| InChIKey | DWDPGMOUEOQUME-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|