C17H13ClN4O3 — CID 25206882
(2S)-2-(4-chlorophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide (PubChem CID 25206882) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
|---|---|
| PubChem CID | 25206882 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-2-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]acetamide |
| SMILES | NC(=O)[C@@H](Nc1c(Nc2ccncc2)c(=O)c1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-10-3-1-9(2-4-10)12(17(19)25)22-14-13(15(23)16(14)24)21-11-5-7-20-8-6-11/h1-8,12,22H,(H2,19,25)(H,20,21)/t12-/m0/s1 |
| InChIKey | KWZXWFRFBBIMPX-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|