C28H44N2O10 — CID 87659895
2-[2-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-prop-2-ynoxybenzamide (PubChem CID 87659895) has the molecular formula C28H44N2O10 and a molecular weight of 568.66 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-prop-2-ynoxybenzamide.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 87659895 |
| Molecular Formula | C28H44N2O10 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1cccc(C(N)=O)c1CCOCCOCCOCCOCCOCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C28H44N2O10/c1-3-9-40-27-6-4-5-26(28(29)32)25(27)7-10-33-12-14-35-16-18-37-20-22-39-23-21-38-19-17-36-15-13-34-11-8-30-24(2)31/h1,4-6H,7-23H2,2H3,(H2,29,32)(H,30,31) |
| InChIKey | CASZHQWKGQEGMT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 146.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|