C14H22ClN5O2 — CID 87662951
[(3R)-1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-3-yl]methyl-tert-butylcarbamic acid (PubChem CID 87662951) has the molecular formula C14H22ClN5O2 and a molecular weight of 327.82 g/mol. Its IUPAC name is [(3R)-1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-3-yl]methyl-tert-butylcarbamic acid.
| Compound Name | [(3R)-1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-3-yl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87662951 |
| Molecular Formula | C14H22ClN5O2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [(3R)-1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-3-yl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C[C@@H]1CCN(c2cc(Cl)nc(N)n2)C1)C(=O)O |
| InChI | InChI=1S/C14H22ClN5O2/c1-14(2,3)20(13(21)22)8-9-4-5-19(7-9)11-6-10(15)17-12(16)18-11/h6,9H,4-5,7-8H2,1-3H3,(H,21,22)(H2,16,17,18)/t9-/m1/s1 |
| InChIKey | MAWXYEHVNMZNMD-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |