C44H71CoNO5-2 — CID 87664267
2,6-ditert-butyl-4-ethylphenol;(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;oxocobalt (PubChem CID 87664267) has the molecular formula C44H71CoNO5-2 and a molecular weight of 752.99 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-ethylphenol;(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;oxocobalt.
| Compound Name | 2,6-ditert-butyl-4-ethylphenol;(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;oxocobalt |
|---|---|
| PubChem CID | 87664267 |
| Molecular Formula | C44H71CoNO5-2 |
| Molecular Weight | 752.99 g/mol |
| Exact Mass | 752.47 |
| IUPAC Name | 2,6-ditert-butyl-4-ethylphenol;(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate;oxocobalt |
| SMILES | O=[Co].[CH2-]CN1C(C)(C)CC(OC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1(C)C.[CH2-]Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H46NO3.C16H25O.Co.O/c1-12-29-27(8,9)17-20(18-28(29,10)11)32-23(30)14-13-19-15-21(25(2,3)4)24(31)22(16-19)26(5,6)7;1-8-11-9-12(15(2,3)4)14(17)13(10-11)16(5,6)7;;/h15-16,20,31H,1,12-14,17-18H2,2-11H3;9-10,17H,1,8H2,2-7H3;;/q2*-1;; |
| InChIKey | OBOFLXKFUTYNCP-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.99 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|