C47H75NO5 — CID 150922217
[1-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-enoxy]butyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 150922217) has the molecular formula C47H75NO5 and a molecular weight of 734.12 g/mol. Its IUPAC name is [1-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-enoxy]butyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | [1-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-enoxy]butyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 150922217 |
| Molecular Formula | C47H75NO5 |
| Molecular Weight | 734.12 g/mol |
| Exact Mass | 733.56 |
| IUPAC Name | [1-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-1-enoxy]butyl]-2,2,6,6-tetramethylpiperidin-4-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCC(CN1C(C)(C)CC(OC(=O)CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1(C)C)OC=CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H75NO5/c1-18-33(52-23-19-20-31-24-35(42(2,3)4)40(50)36(25-31)43(5,6)7)30-48-46(14,15)28-34(29-47(48,16)17)53-39(49)22-21-32-26-37(44(8,9)10)41(51)38(27-32)45(11,12)13/h19,23-27,33-34,50-51H,18,20-22,28-30H2,1-17H3 |
| InChIKey | LEGPPLSKPOMKNZ-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.12 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|