C19H22ClN3O2 — CID 87666295
1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-[(6-chloro-2-pyridinyl)oxy]ethanone (PubChem CID 87666295) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-[(6-chloro-2-pyridinyl)oxy]ethanone.
| Compound Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-[(6-chloro-2-pyridinyl)oxy]ethanone |
|---|---|
| PubChem CID | 87666295 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-[(6-chloro-2-pyridinyl)oxy]ethanone |
| SMILES | NCc1cccc(C2CCN(C(=O)COc3cccc(Cl)n3)CC2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c20-17-5-2-6-18(22-17)25-13-19(24)23-9-7-15(8-10-23)16-4-1-3-14(11-16)12-21/h1-6,11,15H,7-10,12-13,21H2 |
| InChIKey | QHHXHUFXUPEKMF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|