C25H23ClN6O3 — CID 87666816
4-chloro-N-methyl-N-[4-[(3-morpholin-4-ylphenyl)carbamoyl]phenyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 87666816) has the molecular formula C25H23ClN6O3 and a molecular weight of 490.95 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[4-[(3-morpholin-4-ylphenyl)carbamoyl]phenyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 4-chloro-N-methyl-N-[4-[(3-morpholin-4-ylphenyl)carbamoyl]phenyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 87666816 |
| Molecular Formula | C25H23ClN6O3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 4-chloro-N-methyl-N-[4-[(3-morpholin-4-ylphenyl)carbamoyl]phenyl]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CN(C(=O)n1ccc2c(Cl)ncnc21)c1ccc(C(=O)Nc2cccc(N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C25H23ClN6O3/c1-30(25(34)32-10-9-21-22(26)27-16-28-23(21)32)19-7-5-17(6-8-19)24(33)29-18-3-2-4-20(15-18)31-11-13-35-14-12-31/h2-10,15-16H,11-14H2,1H3,(H,29,33) |
| InChIKey | VFFBVTYUXBQKJO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|