C31H26F3N7O3 — CID 11296366
N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-4-[3-(trifluoromethyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 11296366) has the molecular formula C31H26F3N7O3 and a molecular weight of 601.59 g/mol. Its IUPAC name is N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-4-[3-(trifluoromethyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-4-[3-(trifluoromethyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 11296366 |
| Molecular Formula | C31H26F3N7O3 |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-[3-[(4-morpholin-4-ylphenyl)carbamoyl]phenyl]-4-[3-(trifluoromethyl)anilino]pyrrolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cccc(NC(=O)n2ccc3c(Nc4cccc(C(F)(F)F)c4)ncnc32)c1 |
| InChI | InChI=1S/C31H26F3N7O3/c32-31(33,34)21-4-2-6-24(18-21)37-27-26-11-12-41(28(26)36-19-35-27)30(43)39-23-5-1-3-20(17-23)29(42)38-22-7-9-25(10-8-22)40-13-15-44-16-14-40/h1-12,17-19H,13-16H2,(H,38,42)(H,39,43)(H,35,36,37) |
| InChIKey | MJGAXHSYLCJQTG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|