C15H13ClN3O5PS — CID 87667775
(2-chloro-3-pyridinyl)oxy-[(isoquinolin-5-ylsulfonylamino)methyl]phosphinic acid (PubChem CID 87667775) has the molecular formula C15H13ClN3O5PS and a molecular weight of 413.78 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)oxy-[(isoquinolin-5-ylsulfonylamino)methyl]phosphinic acid.
| Compound Name | (2-chloro-3-pyridinyl)oxy-[(isoquinolin-5-ylsulfonylamino)methyl]phosphinic acid |
|---|---|
| PubChem CID | 87667775 |
| Molecular Formula | C15H13ClN3O5PS |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (2-chloro-3-pyridinyl)oxy-[(isoquinolin-5-ylsulfonylamino)methyl]phosphinic acid |
| SMILES | O=P(O)(CNS(=O)(=O)c1cccc2cnccc12)Oc1cccnc1Cl |
| InChI | InChI=1S/C15H13ClN3O5PS/c16-15-13(4-2-7-18-15)24-25(20,21)10-19-26(22,23)14-5-1-3-11-9-17-8-6-12(11)14/h1-9,19H,10H2,(H,20,21) |
| InChIKey | OFLHIRSXTCZQPB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|