C19H18ClN4O6PS — CID 87667904
(2-chloro-3-pyridinyl)oxy-[[[3-(phenylcarbamoylamino)phenyl]sulfonylamino]methyl]phosphinic acid (PubChem CID 87667904) has the molecular formula C19H18ClN4O6PS and a molecular weight of 496.87 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)oxy-[[[3-(phenylcarbamoylamino)phenyl]sulfonylamino]methyl]phosphinic acid.
| Compound Name | (2-chloro-3-pyridinyl)oxy-[[[3-(phenylcarbamoylamino)phenyl]sulfonylamino]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87667904 |
| Molecular Formula | C19H18ClN4O6PS |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | (2-chloro-3-pyridinyl)oxy-[[[3-(phenylcarbamoylamino)phenyl]sulfonylamino]methyl]phosphinic acid |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(S(=O)(=O)NCP(=O)(O)Oc2cccnc2Cl)c1 |
| InChI | InChI=1S/C19H18ClN4O6PS/c20-18-17(10-5-11-21-18)30-31(26,27)13-22-32(28,29)16-9-4-8-15(12-16)24-19(25)23-14-6-2-1-3-7-14/h1-12,22H,13H2,(H,26,27)(H2,23,24,25) |
| InChIKey | KBFRTNWMWYXGHR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|