C10H11ClN2NaO6PS — CID 173131583
sodium;(2-chloro-3-pyridinyl)oxy-[(furan-3-ylsulfonylamino)methyl]phosphinic acid;hydride (PubChem CID 173131583) has the molecular formula C10H11ClN2NaO6PS and a molecular weight of 376.69 g/mol. Its IUPAC name is sodium;(2-chloro-3-pyridinyl)oxy-[(furan-3-ylsulfonylamino)methyl]phosphinic acid;hydride.
| Compound Name | sodium;(2-chloro-3-pyridinyl)oxy-[(furan-3-ylsulfonylamino)methyl]phosphinic acid;hydride |
|---|---|
| PubChem CID | 173131583 |
| Molecular Formula | C10H11ClN2NaO6PS |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | sodium;(2-chloro-3-pyridinyl)oxy-[(furan-3-ylsulfonylamino)methyl]phosphinic acid;hydride |
| SMILES | O=P(O)(CNS(=O)(=O)c1ccoc1)Oc1cccnc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C10H10ClN2O6PS.Na.H/c11-10-9(2-1-4-12-10)19-20(14,15)7-13-21(16,17)8-3-5-18-6-8;;/h1-6,13H,7H2,(H,14,15);;/q;+1;-1 |
| InChIKey | TXDLYGLYYRYJSS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|