C19H17N3O2S — CID 87668770
3-methyl-3-(1-oxidopyridin-1-ium-4-yl)-N-(1,3-thiazol-2-yl)-1,2-dihydroindene-2-carboxamide (PubChem CID 87668770) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-methyl-3-(1-oxidopyridin-1-ium-4-yl)-N-(1,3-thiazol-2-yl)-1,2-dihydroindene-2-carboxamide.
| Compound Name | 3-methyl-3-(1-oxidopyridin-1-ium-4-yl)-N-(1,3-thiazol-2-yl)-1,2-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 87668770 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-methyl-3-(1-oxidopyridin-1-ium-4-yl)-N-(1,3-thiazol-2-yl)-1,2-dihydroindene-2-carboxamide |
| SMILES | CC1(c2cc[n+]([O-])cc2)c2ccccc2CC1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C19H17N3O2S/c1-19(14-6-9-22(24)10-7-14)15-5-3-2-4-13(15)12-16(19)17(23)21-18-20-8-11-25-18/h2-11,16H,12H2,1H3,(H,20,21,23) |
| InChIKey | WHWLAWUQXKSYFB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|