C21H17FN2O3 — CID 87670471
(4-fluorobenzoyl) 2-methyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate (PubChem CID 87670471) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is (4-fluorobenzoyl) 2-methyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate.
| Compound Name | (4-fluorobenzoyl) 2-methyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 87670471 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4-fluorobenzoyl) 2-methyl-1,2,3,6-tetrahydroazepino[4,5-b]indole-5-carboxylate |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(C(=O)OC(=O)c2ccc(F)cc2)=CN1 |
| InChI | InChI=1S/C21H17FN2O3/c1-12-10-16-15-4-2-3-5-18(15)24-19(16)17(11-23-12)21(26)27-20(25)13-6-8-14(22)9-7-13/h2-9,11-12,23-24H,10H2,1H3 |
| InChIKey | HFKHLWXFRILRCJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|