1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid

C14H12N2O4 — CID 66768541

IUPAC1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid
SMILESO=C(O)C1=CNC(C(=O)O)Cc2c1[nH]c1ccccc21
InChIInChI=1S/C14H12N2O4/c17-13(18)9-6-15-11(14(19)20)5-8-7-3-1-2-4-10(7)16-12(8)9/h1-4,6,11,15-16H,5H2,(H,17,18)(H,19,20)
InChIKeyHIKYWVQFROCJNN-UHFFFAOYSA-N
MW272.26 g/mol
LogP1.19
Rot. Bonds2

About 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid

1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid (PubChem CID 66768541) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid.

Molecular Properties

Compound Name1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid
PubChem CID66768541
Molecular FormulaC14H12N2O4
Molecular Weight272.26 g/mol
Exact Mass272.08
IUPAC Name1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid
SMILESO=C(O)C1=CNC(C(=O)O)Cc2c1[nH]c1ccccc21
InChIInChI=1S/C14H12N2O4/c17-13(18)9-6-15-11(14(19)20)5-8-7-3-1-2-4-10(7)16-12(8)9/h1-4,6,11,15-16H,5H2,(H,17,18)(H,19,20)
InChIKeyHIKYWVQFROCJNN-UHFFFAOYSA-N
XLogP1.19
TPSA102.42 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.26
LogP ≤ 51.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid?
The IUPAC name of 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid (CID 66768541) is 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid.
What is the SMILES notation for 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid?
The canonical SMILES for 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid is O=C(O)C1=CNC(C(=O)O)Cc2c1[nH]c1ccccc21.
What is the InChIKey of 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid?
The InChIKey is HIKYWVQFROCJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O4/c17-13(18)9-6-15-11(14(19)20)5-8-7-3-1-2-4-10(7)16-12(8)9/h1-4,6,11,15-16H,5H2,(H,17,18)(H,19,20).
What are the key properties of 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid?
1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid has a molecular weight of 272.26 g/mol, XLogP of 1.19, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,6-tetrahydroazepino[4,5-b]indole-2,5-dicarboxylic acid is sourced from PubChem (CID 66768541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).