C18H20N2O4 — CID 66641209
(2R)-1,1-diethyl-3,6-dihydro-2H-azepino[4,5-b]indole-2,5-dicarboxylic acid (PubChem CID 66641209) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2R)-1,1-diethyl-3,6-dihydro-2H-azepino[4,5-b]indole-2,5-dicarboxylic acid.
| Compound Name | (2R)-1,1-diethyl-3,6-dihydro-2H-azepino[4,5-b]indole-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 66641209 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2R)-1,1-diethyl-3,6-dihydro-2H-azepino[4,5-b]indole-2,5-dicarboxylic acid |
| SMILES | CCC1(CC)c2c([nH]c3ccccc23)C(C(=O)O)=CN[C@H]1C(=O)O |
| InChI | InChI=1S/C18H20N2O4/c1-3-18(4-2)13-10-7-5-6-8-12(10)20-14(13)11(16(21)22)9-19-15(18)17(23)24/h5-9,15,19-20H,3-4H2,1-2H3,(H,21,22)(H,23,24)/t15-/m0/s1 |
| InChIKey | ZFFDCMROBNRXAV-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |