C24H33NO2 — CID 91236935
10,10-dimethyl-5H-indeno[1,2-b]indole-1-carboxylic acid;ethane (PubChem CID 91236935) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 10,10-dimethyl-5H-indeno[1,2-b]indole-1-carboxylic acid;ethane.
| Compound Name | 10,10-dimethyl-5H-indeno[1,2-b]indole-1-carboxylic acid;ethane |
|---|---|
| PubChem CID | 91236935 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 10,10-dimethyl-5H-indeno[1,2-b]indole-1-carboxylic acid;ethane |
| SMILES | CC.CC.CC.CC1(C)c2c(C(=O)O)cccc2-c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C18H15NO2.3C2H6/c1-18(2)14-11(7-5-8-12(14)17(20)21)16-15(18)10-6-3-4-9-13(10)19-16;3*1-2/h3-9,19H,1-2H3,(H,20,21);3*1-2H3 |
| InChIKey | NVMSMPUGICCYTJ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |