C21H18N2O3 — CID 68994218
3-benzoyl-2-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylic acid (PubChem CID 68994218) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-benzoyl-2-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylic acid.
| Compound Name | 3-benzoyl-2-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 68994218 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-benzoyl-2-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylic acid |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(C(=O)O)=CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c1-13-11-16-15-9-5-6-10-18(15)22-19(16)17(21(25)26)12-23(13)20(24)14-7-3-2-4-8-14/h2-10,12-13,22H,11H2,1H3,(H,25,26) |
| InChIKey | XQYPLERXFNHLRW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |