C21H17N3O — CID 10687652
8-methyl-5-phenyl-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one (PubChem CID 10687652) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 8-methyl-5-phenyl-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one.
| Compound Name | 8-methyl-5-phenyl-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one |
|---|---|
| PubChem CID | 10687652 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 8-methyl-5-phenyl-3,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-6-one |
| SMILES | CC1Cc2c([nH]c3ccccc23)-c2ncc(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C21H17N3O/c1-13-11-16-15-9-5-6-10-18(15)23-19(16)20-22-12-17(21(25)24(13)20)14-7-3-2-4-8-14/h2-10,12-13,23H,11H2,1H3 |
| InChIKey | MQXKNMSXRALBRQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|