C20H14N2O4 — CID 73254373
21-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-12-carboxylic acid (PubChem CID 73254373) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 21-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-12-carboxylic acid.
| Compound Name | 21-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-12-carboxylic acid |
|---|---|
| PubChem CID | 73254373 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 21-hydroxy-14-oxo-11,12-dihydro-3H-yohimban-12-carboxylic acid |
| SMILES | O=C(O)C1Cc2c([nH]c3ccccc23)-c2c(O)c3ccccc3c(=O)n21 |
| InChI | InChI=1S/C20H14N2O4/c23-18-11-6-1-2-7-12(11)19(24)22-15(20(25)26)9-13-10-5-3-4-8-14(10)21-16(13)17(18)22/h1-8,15,21,23H,9H2,(H,25,26) |
| InChIKey | FNAHVCQRCYNMPV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|