C19H19N3O — CID 135703738
12-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20)-hexaen-14-one (PubChem CID 135703738) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 12-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20)-hexaen-14-one.
| Compound Name | 12-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20)-hexaen-14-one |
|---|---|
| PubChem CID | 135703738 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 12-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20)-hexaen-14-one |
| SMILES | CC1Cc2c([nH]c3ccccc23)-c2nc3c(c(=O)n21)CCCC3 |
| InChI | InChI=1S/C19H19N3O/c1-11-10-14-12-6-2-4-8-15(12)20-17(14)18-21-16-9-5-3-7-13(16)19(23)22(11)18/h2,4,6,8,11,20H,3,5,7,9-10H2,1H3 |
| InChIKey | IOVKYFWVCBOZTL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|