C11H12O3S — CID 87671900
ethyl 3-oxo-3-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)propanoate (PubChem CID 87671900) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is ethyl 3-oxo-3-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)propanoate.
| Compound Name | ethyl 3-oxo-3-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 87671900 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | ethyl 3-oxo-3-(3-sulfanylidenecyclohexa-1,5-dien-1-yl)propanoate |
| SMILES | CCOC(=O)CC(=O)C1=CC(=S)CC=C1 |
| InChI | InChI=1S/C11H12O3S/c1-2-14-11(13)7-10(12)8-4-3-5-9(15)6-8/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | VWMJFWUOOOPYOC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|