C12H13N3O2S — CID 87707238
ethyl 3-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]-1H-pyrazole-5-carboxylate (PubChem CID 87707238) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is ethyl 3-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 87707238 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl 3-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)amino]-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(NC2=CC(=S)CC=C2)n[nH]1 |
| InChI | InChI=1S/C12H13N3O2S/c1-2-17-12(16)10-7-11(15-14-10)13-8-4-3-5-9(18)6-8/h3-4,6-7H,2,5H2,1H3,(H2,13,14,15) |
| InChIKey | ROKDPGJHRLNZLL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|