C12H23N3O4 — CID 8767199
ethyl N-[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetyl]carbamate (PubChem CID 8767199) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl N-[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 8767199 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl N-[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-6-19-11(18)13-9(16)7-15(5)8-10(17)14-12(2,3)4/h6-8H2,1-5H3,(H,14,17)(H,13,16,18) |
| InChIKey | PJKWEIMGGPQWCE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |