About cerium;nonanoic acid
cerium;nonanoic acid (PubChem CID 87682683) has the molecular formula C9H18CeO2
and a molecular weight of 298.36 g/mol. Its IUPAC name is cerium;nonanoic acid.
Molecular Properties
| Compound Name | cerium;nonanoic acid |
| PubChem CID | 87682683 |
| Molecular Formula | C9H18CeO2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | cerium;nonanoic acid |
| SMILES | CCCCCCCCC(=O)O.[Ce] |
| InChI | InChI=1S/C9H18O2.Ce/c1-2-3-4-5-6-7-8-9(10)11;/h2-8H2,1H3,(H,10,11); |
| InChIKey | FHBCYJLQIXKFGG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cerium;nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;nonanoic acid?
The IUPAC name of cerium;nonanoic acid (CID 87682683) is cerium;nonanoic acid.
What is the SMILES notation for cerium;nonanoic acid?
The canonical SMILES for cerium;nonanoic acid is CCCCCCCCC(=O)O.[Ce].
What is the InChIKey of cerium;nonanoic acid?
The InChIKey is FHBCYJLQIXKFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.Ce/c1-2-3-4-5-6-7-8-9(10)11;/h2-8H2,1H3,(H,10,11);.
What are the key properties of cerium;nonanoic acid?
cerium;nonanoic acid has a molecular weight of 298.36 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;nonanoic acid is sourced from PubChem (CID 87682683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).