C10H19NO2 — CID 87683291
N,2,3-trimethyl-5-oxoheptanamide (PubChem CID 87683291) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N,2,3-trimethyl-5-oxoheptanamide.
| Compound Name | N,2,3-trimethyl-5-oxoheptanamide |
|---|---|
| PubChem CID | 87683291 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N,2,3-trimethyl-5-oxoheptanamide |
| SMILES | CCC(=O)CC(C)C(C)C(=O)NC |
| InChI | InChI=1S/C10H19NO2/c1-5-9(12)6-7(2)8(3)10(13)11-4/h7-8H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | DJQPZOLWVWNGJA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |