C21H32O4 — CID 87691158
3-octadeca-1,3-diynoxy-3-oxopropanoic acid (PubChem CID 87691158) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 3-octadeca-1,3-diynoxy-3-oxopropanoic acid.
| Compound Name | 3-octadeca-1,3-diynoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 87691158 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 3-octadeca-1,3-diynoxy-3-oxopropanoic acid |
| SMILES | CCCCCCCCCCCCCCC#CC#COC(=O)CC(=O)O |
| InChI | InChI=1S/C21H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-21(24)19-20(22)23/h2-14,19H2,1H3,(H,22,23) |
| InChIKey | DQINKNXJSYCZOT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|