C11H10Cl2N2O3S2 — CID 87692464
2-chloro-4-morpholin-4-ylthieno[3,2-c]pyridine-6-sulfonyl chloride (PubChem CID 87692464) has the molecular formula C11H10Cl2N2O3S2 and a molecular weight of 353.25 g/mol. Its IUPAC name is 2-chloro-4-morpholin-4-ylthieno[3,2-c]pyridine-6-sulfonyl chloride.
| Compound Name | 2-chloro-4-morpholin-4-ylthieno[3,2-c]pyridine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 87692464 |
| Molecular Formula | C11H10Cl2N2O3S2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 2-chloro-4-morpholin-4-ylthieno[3,2-c]pyridine-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc2sc(Cl)cc2c(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H10Cl2N2O3S2/c12-9-5-7-8(19-9)6-10(20(13,16)17)14-11(7)15-1-3-18-4-2-15/h5-6H,1-4H2 |
| InChIKey | PVQFTVMRKNUTSS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |