C22H24N4O2S — CID 87695058
1-(1-isoquinolin-1-ylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-sulfanylurea (PubChem CID 87695058) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-(1-isoquinolin-1-ylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-sulfanylurea.
| Compound Name | 1-(1-isoquinolin-1-ylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87695058 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-(1-isoquinolin-1-ylpiperidin-4-yl)-3-(3-methoxyphenyl)-1-sulfanylurea |
| SMILES | COc1cccc(NC(=O)N(S)C2CCN(c3nccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C22H24N4O2S/c1-28-19-7-4-6-17(15-19)24-22(27)26(29)18-10-13-25(14-11-18)21-20-8-3-2-5-16(20)9-12-23-21/h2-9,12,15,18,29H,10-11,13-14H2,1H3,(H,24,27) |
| InChIKey | PTONIGPUFRCYQJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|