C21H22BrN5O2S — CID 87695117
1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(3-methoxyphenyl)-1-sulfanylurea (PubChem CID 87695117) has the molecular formula C21H22BrN5O2S and a molecular weight of 488.41 g/mol. Its IUPAC name is 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(3-methoxyphenyl)-1-sulfanylurea.
| Compound Name | 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(3-methoxyphenyl)-1-sulfanylurea |
|---|---|
| PubChem CID | 87695117 |
| Molecular Formula | C21H22BrN5O2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(3-methoxyphenyl)-1-sulfanylurea |
| SMILES | COc1cccc(NC(=O)N(S)C2CCN(c3nncc4ccc(Br)cc34)CC2)c1 |
| InChI | InChI=1S/C21H22BrN5O2S/c1-29-18-4-2-3-16(12-18)24-21(28)27(30)17-7-9-26(10-8-17)20-19-11-15(22)6-5-14(19)13-23-25-20/h2-6,11-13,17,30H,7-10H2,1H3,(H,24,28) |
| InChIKey | JGDITIXSHYSAPG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|