C22H26 — CID 87703077
4-(3,5-dimethylphenyl)-5-ethyl-2-propan-2-yl-1H-indene (PubChem CID 87703077) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-5-ethyl-2-propan-2-yl-1H-indene.
| Compound Name | 4-(3,5-dimethylphenyl)-5-ethyl-2-propan-2-yl-1H-indene |
|---|---|
| PubChem CID | 87703077 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-5-ethyl-2-propan-2-yl-1H-indene |
| SMILES | CCc1ccc2c(c1-c1cc(C)cc(C)c1)C=C(C(C)C)C2 |
| InChI | InChI=1S/C22H26/c1-6-17-7-8-18-12-19(14(2)3)13-21(18)22(17)20-10-15(4)9-16(5)11-20/h7-11,13-14H,6,12H2,1-5H3 |
| InChIKey | OTXMOOSSCTYEJC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |