C23H28 — CID 87703373
2-butyl-4-(3,5-dimethylphenyl)-5-ethyl-1H-indene (PubChem CID 87703373) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-butyl-4-(3,5-dimethylphenyl)-5-ethyl-1H-indene.
| Compound Name | 2-butyl-4-(3,5-dimethylphenyl)-5-ethyl-1H-indene |
|---|---|
| PubChem CID | 87703373 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-butyl-4-(3,5-dimethylphenyl)-5-ethyl-1H-indene |
| SMILES | CCCCC1=Cc2c(ccc(CC)c2-c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C23H28/c1-5-7-8-18-14-20-10-9-19(6-2)23(22(20)15-18)21-12-16(3)11-17(4)13-21/h9-13,15H,5-8,14H2,1-4H3 |
| InChIKey | GSHLWBOCZYONGG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |