C25H32 — CID 87702765
2-butyl-5-tert-butyl-4-(3,5-dimethylphenyl)-1H-indene (PubChem CID 87702765) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 2-butyl-5-tert-butyl-4-(3,5-dimethylphenyl)-1H-indene.
| Compound Name | 2-butyl-5-tert-butyl-4-(3,5-dimethylphenyl)-1H-indene |
|---|---|
| PubChem CID | 87702765 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 2-butyl-5-tert-butyl-4-(3,5-dimethylphenyl)-1H-indene |
| SMILES | CCCCC1=Cc2c(ccc(C(C)(C)C)c2-c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C25H32/c1-7-8-9-19-15-20-10-11-23(25(4,5)6)24(22(20)16-19)21-13-17(2)12-18(3)14-21/h10-14,16H,7-9,15H2,1-6H3 |
| InChIKey | WPEIBEMCXTZQEA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |