C29H32 — CID 87142110
2-butyl-4,7-bis(3,5-dimethylphenyl)-1H-indene (PubChem CID 87142110) has the molecular formula C29H32 and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-butyl-4,7-bis(3,5-dimethylphenyl)-1H-indene.
| Compound Name | 2-butyl-4,7-bis(3,5-dimethylphenyl)-1H-indene |
|---|---|
| PubChem CID | 87142110 |
| Molecular Formula | C29H32 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-butyl-4,7-bis(3,5-dimethylphenyl)-1H-indene |
| SMILES | CCCCC1=Cc2c(-c3cc(C)cc(C)c3)ccc(-c3cc(C)cc(C)c3)c2C1 |
| InChI | InChI=1S/C29H32/c1-6-7-8-23-17-28-26(24-13-19(2)11-20(3)14-24)9-10-27(29(28)18-23)25-15-21(4)12-22(5)16-25/h9-17H,6-8,18H2,1-5H3 |
| InChIKey | SKANABJRDOKQHC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |