About tripropylsilyl 4-hydroxybutanoate
tripropylsilyl 4-hydroxybutanoate (PubChem CID 87706065) has the molecular formula C13H28O3Si
and a molecular weight of 260.45 g/mol. Its IUPAC name is tripropylsilyl 4-hydroxybutanoate.
Molecular Properties
| Compound Name | tripropylsilyl 4-hydroxybutanoate |
| PubChem CID | 87706065 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | tripropylsilyl 4-hydroxybutanoate |
| SMILES | CCC[Si](CCC)(CCC)OC(=O)CCCO |
| InChI | InChI=1S/C13H28O3Si/c1-4-10-17(11-5-2,12-6-3)16-13(15)8-7-9-14/h14H,4-12H2,1-3H3 |
| InChIKey | FYDNTPPRJJGYNL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripropylsilyl 4-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripropylsilyl 4-hydroxybutanoate?
The IUPAC name of tripropylsilyl 4-hydroxybutanoate (CID 87706065) is tripropylsilyl 4-hydroxybutanoate.
What is the SMILES notation for tripropylsilyl 4-hydroxybutanoate?
The canonical SMILES for tripropylsilyl 4-hydroxybutanoate is CCC[Si](CCC)(CCC)OC(=O)CCCO.
What is the InChIKey of tripropylsilyl 4-hydroxybutanoate?
The InChIKey is FYDNTPPRJJGYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3Si/c1-4-10-17(11-5-2,12-6-3)16-13(15)8-7-9-14/h14H,4-12H2,1-3H3.
What are the key properties of tripropylsilyl 4-hydroxybutanoate?
tripropylsilyl 4-hydroxybutanoate has a molecular weight of 260.45 g/mol, XLogP of 3.48, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tripropylsilyl 4-hydroxybutanoate is sourced from PubChem (CID 87706065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).