C18H14O4S — CID 87707065
5-naphthalen-1-yl-2,3-dihydro-1-benzofuran-7-sulfonic acid (PubChem CID 87707065) has the molecular formula C18H14O4S and a molecular weight of 326.37 g/mol. Its IUPAC name is 5-naphthalen-1-yl-2,3-dihydro-1-benzofuran-7-sulfonic acid.
| Compound Name | 5-naphthalen-1-yl-2,3-dihydro-1-benzofuran-7-sulfonic acid |
|---|---|
| PubChem CID | 87707065 |
| Molecular Formula | C18H14O4S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-naphthalen-1-yl-2,3-dihydro-1-benzofuran-7-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(-c2cccc3ccccc23)cc2c1OCC2 |
| InChI | InChI=1S/C18H14O4S/c19-23(20,21)17-11-14(10-13-8-9-22-18(13)17)16-7-3-5-12-4-1-2-6-15(12)16/h1-7,10-11H,8-9H2,(H,19,20,21) |
| InChIKey | PCBHTKDJAQZNML-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|