C19H30N2O4S — CID 87710902
2-amino-2-(heptan-4-ylsulfonylmethyl)-3-oxo-5-phenylpentanamide (PubChem CID 87710902) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-oxo-5-phenylpentanamide.
| Compound Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 87710902 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-oxo-5-phenylpentanamide |
| SMILES | CCCC(CCC)S(=O)(=O)CC(N)(C(N)=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O4S/c1-3-8-16(9-4-2)26(24,25)14-19(21,18(20)23)17(22)13-12-15-10-6-5-7-11-15/h5-7,10-11,16H,3-4,8-9,12-14,21H2,1-2H3,(H2,20,23) |
| InChIKey | IQKOVTJEYGWJSV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|