C18H28N2O4S — CID 87710884
2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-methylphenyl)-3-oxopropanamide (PubChem CID 87710884) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-methylphenyl)-3-oxopropanamide.
| Compound Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-methylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 87710884 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-methylphenyl)-3-oxopropanamide |
| SMILES | CCCC(CCC)S(=O)(=O)CC(N)(C(N)=O)C(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-4-7-15(8-5-2)25(23,24)12-18(20,17(19)22)16(21)14-10-6-9-13(3)11-14/h6,9-11,15H,4-5,7-8,12,20H2,1-3H3,(H2,19,22) |
| InChIKey | TWUXHTKOMFQXMP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|