C12H14F2O — CID 142960653
2,2-difluoro-3-methyl-1-(3-methylphenyl)butan-1-one (PubChem CID 142960653) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-1-(3-methylphenyl)butan-1-one.
| Compound Name | 2,2-difluoro-3-methyl-1-(3-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 142960653 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,2-difluoro-3-methyl-1-(3-methylphenyl)butan-1-one |
| SMILES | Cc1cccc(C(=O)C(F)(F)C(C)C)c1 |
| InChI | InChI=1S/C12H14F2O/c1-8(2)12(13,14)11(15)10-6-4-5-9(3)7-10/h4-8H,1-3H3 |
| InChIKey | DOBCKKJRCPLHQK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |